C27H30O8 — CID 3679336
tert-butyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate (PubChem CID 3679336) has the molecular formula C27H30O8 and a molecular weight of 482.53 g/mol. Its IUPAC name is tert-butyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate.
| Compound Name | tert-butyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3679336 |
| Molecular Formula | C27H30O8 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | tert-butyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate |
| SMILES | COc1ccc(-c2c(C(=O)OC(C)(C)C)cc(OC(C)=O)c3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C27H30O8/c1-15(28)34-21-14-19(26(29)35-27(2,3)4)25(16-9-10-20(30-5)22(11-16)31-6)18-13-24(33-8)23(32-7)12-17(18)21/h9-14H,1-8H3 |
| InChIKey | KYCVFXNLQDHUOO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|