C17H18O5S — CID 122520347
[4-(3,4-dimethoxyphenyl)sulfanyl-2-methoxyphenyl] acetate (PubChem CID 122520347) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)sulfanyl-2-methoxyphenyl] acetate.
| Compound Name | [4-(3,4-dimethoxyphenyl)sulfanyl-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 122520347 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)sulfanyl-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(Sc2ccc(OC(C)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C17H18O5S/c1-11(18)22-15-8-6-13(10-17(15)21-4)23-12-5-7-14(19-2)16(9-12)20-3/h5-10H,1-4H3 |
| InChIKey | AYBXXHYBMDONBY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|