About 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one
3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 3478799) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one |
| PubChem CID | 3478799 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2O |
| InChI | InChI=1S/C10H10O5/c1-13-6-4-3-5-7(8(6)14-2)10(12)15-9(5)11/h3-4,9,11H,1-2H3 |
| InChIKey | BYISGJCPRCCOPJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one?
The IUPAC name of 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one (CID 3478799) is 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one?
The canonical SMILES for 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one is COc1ccc2c(c1OC)C(=O)OC2O.
What is the InChIKey of 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one?
The InChIKey is BYISGJCPRCCOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-13-6-4-3-5-7(8(6)14-2)10(12)15-9(5)11/h3-4,9,11H,1-2H3.
What are the key properties of 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one?
3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one has a molecular weight of 210.18 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6,7-dimethoxy-3H-2-benzofuran-1-one is sourced from PubChem (CID 3478799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).