C14H18NO5+ — CID 7038493
(3S)-6,7-dimethoxy-3-morpholin-4-ium-4-yl-3H-2-benzofuran-1-one (PubChem CID 7038493) has the molecular formula C14H18NO5+ and a molecular weight of 280.30 g/mol. Its IUPAC name is (3S)-6,7-dimethoxy-3-morpholin-4-ium-4-yl-3H-2-benzofuran-1-one.
| Compound Name | (3S)-6,7-dimethoxy-3-morpholin-4-ium-4-yl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 7038493 |
| Molecular Formula | C14H18NO5+ |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3S)-6,7-dimethoxy-3-morpholin-4-ium-4-yl-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2[NH+]1CCOCC1 |
| InChI | InChI=1S/C14H17NO5/c1-17-10-4-3-9-11(12(10)18-2)14(16)20-13(9)15-5-7-19-8-6-15/h3-4,13H,5-8H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | FIKHXMYWYPVKNH-ZDUSSCGKSA-O |
| XLogP | -0.21 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |