C12H12O6 — CID 166624717
(2R)-2-(7,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl)propanoic acid (PubChem CID 166624717) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is (2R)-2-(7,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl)propanoic acid.
| Compound Name | (2R)-2-(7,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 166624717 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (2R)-2-(7,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl)propanoic acid |
| SMILES | C[C@@H](C(=O)O)C1Cc2ccc(O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H12O6/c1-5(11(15)16)8-4-6-2-3-7(13)10(14)9(6)12(17)18-8/h2-3,5,8,13-14H,4H2,1H3,(H,15,16)/t5-,8?/m1/s1 |
| InChIKey | IGDCZUUGXSDKSG-RUQIKYNFSA-N |
| XLogP | 0.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|