C10H10O4 — CID 155818936
(3R)-3-ethyl-6,7-dihydroxy-3H-2-benzofuran-1-one (PubChem CID 155818936) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3R)-3-ethyl-6,7-dihydroxy-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-ethyl-6,7-dihydroxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 155818936 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3R)-3-ethyl-6,7-dihydroxy-3H-2-benzofuran-1-one |
| SMILES | CC[C@H]1OC(=O)c2c1ccc(O)c2O |
| InChI | InChI=1S/C10H10O4/c1-2-7-5-3-4-6(11)9(12)8(5)10(13)14-7/h3-4,7,11-12H,2H2,1H3/t7-/m1/s1 |
| InChIKey | DMJVRDSZDKSVDH-SSDOTTSWSA-N |
| XLogP | 1.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|