C15H12O5 — CID 95931194
(12R,14S,15R)-4,15-dihydroxy-14-methyl-13-oxatetracyclo[8.5.0.03,8.012,14]pentadeca-1(10),3(8),4,6-tetraene-2,9-dione (PubChem CID 95931194) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (12R,14S,15R)-4,15-dihydroxy-14-methyl-13-oxatetracyclo[8.5.0.03,8.012,14]pentadeca-1(10),3(8),4,6-tetraene-2,9-dione.
| Compound Name | (12R,14S,15R)-4,15-dihydroxy-14-methyl-13-oxatetracyclo[8.5.0.03,8.012,14]pentadeca-1(10),3(8),4,6-tetraene-2,9-dione |
|---|---|
| PubChem CID | 95931194 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (12R,14S,15R)-4,15-dihydroxy-14-methyl-13-oxatetracyclo[8.5.0.03,8.012,14]pentadeca-1(10),3(8),4,6-tetraene-2,9-dione |
| SMILES | C[C@@]12O[C@@H]1CC1=C(C(=O)c3c(O)cccc3C1=O)[C@H]2O |
| InChI | InChI=1S/C15H12O5/c1-15-9(20-15)5-7-11(14(15)19)13(18)10-6(12(7)17)3-2-4-8(10)16/h2-4,9,14,16,19H,5H2,1H3/t9-,14-,15-/m1/s1 |
| InChIKey | PWZWXWNRTSNRTP-DFKRKDTASA-N |
| XLogP | 0.99 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|