C19H20O6 — CID 100978986
methyl 2-[(1R,3R)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate (PubChem CID 100978986) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate.
| Compound Name | methyl 2-[(1R,3R)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
|---|---|
| PubChem CID | 100978986 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 2-[(1R,3R)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
| SMILES | CCC[C@H]1O[C@@H](CC(=O)OC)CC2=C1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C19H20O6/c1-3-5-14-17-12(8-10(25-14)9-15(21)24-2)18(22)11-6-4-7-13(20)16(11)19(17)23/h4,6-7,10,14,20H,3,5,8-9H2,1-2H3/t10-,14-/m1/s1 |
| InChIKey | WBMODGJRMQELTN-QMTHXVAHSA-N |
| XLogP | 2.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|