C18H18O5 — CID 42624573
2-[(1R,3S)-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid (PubChem CID 42624573) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[(1R,3S)-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid.
| Compound Name | 2-[(1R,3S)-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 42624573 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[(1R,3S)-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
| SMILES | CCC[C@H]1O[C@H](CC(=O)O)CC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H18O5/c1-2-5-14-16-13(8-10(23-14)9-15(19)20)17(21)11-6-3-4-7-12(11)18(16)22/h3-4,6-7,10,14H,2,5,8-9H2,1H3,(H,19,20)/t10-,14+/m0/s1 |
| InChIKey | INFIHDGKUKRWTC-IINYFYTJSA-N |
| XLogP | 2.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|