C21H20O10 — CID 24770477
methyl 2-[(1S,3S,3'R,4S,6'R)-3',4,9-trihydroxy-6'-methyl-4',5,10-trioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate (PubChem CID 24770477) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is methyl 2-[(1S,3S,3'R,4S,6'R)-3',4,9-trihydroxy-6'-methyl-4',5,10-trioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate.
| Compound Name | methyl 2-[(1S,3S,3'R,4S,6'R)-3',4,9-trihydroxy-6'-methyl-4',5,10-trioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate |
|---|---|
| PubChem CID | 24770477 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | methyl 2-[(1S,3S,3'R,4S,6'R)-3',4,9-trihydroxy-6'-methyl-4',5,10-trioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@]2(O[C@H](C)CC(=O)[C@H]2O)C2=C(C(=O)c3cccc(O)c3C2=O)[C@@H]1O |
| InChI | InChI=1S/C21H20O10/c1-8-6-11(23)20(28)21(30-8)16-15(18(26)12(31-21)7-13(24)29-2)17(25)9-4-3-5-10(22)14(9)19(16)27/h3-5,8,12,18,20,22,26,28H,6-7H2,1-2H3/t8-,12+,18-,20-,21+/m1/s1 |
| InChIKey | QGLJKFQKQQJESJ-LQGDCONQSA-N |
| XLogP | -0.17 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|