C14H12O7 — CID 141286247
1,2,3,4,5-pentahydroxy-1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 141286247) has the molecular formula C14H12O7 and a molecular weight of 292.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentahydroxy-1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | 1,2,3,4,5-pentahydroxy-1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 141286247 |
| Molecular Formula | C14H12O7 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1,2,3,4,5-pentahydroxy-1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | O=C1C2=C(C(=O)c3c(O)cccc31)C(O)C(O)C(O)C2O |
| InChI | InChI=1S/C14H12O7/c15-5-3-1-2-4-6(5)10(17)8-7(9(4)16)11(18)13(20)14(21)12(8)19/h1-3,11-15,18-21H |
| InChIKey | ZATPOKXRTVBQBI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|