C17H15NO4 — CID 20527645
2-[(dimethylamino)methyl]-1,8-dihydroxyanthracene-9,10-dione (PubChem CID 20527645) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-[(dimethylamino)methyl]-1,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 20527645 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1,8-dihydroxyanthracene-9,10-dione |
| SMILES | CN(C)Cc1ccc2c(c1O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C17H15NO4/c1-18(2)8-9-6-7-11-14(15(9)20)17(22)13-10(16(11)21)4-3-5-12(13)19/h3-7,19-20H,8H2,1-2H3 |
| InChIKey | QKKQIDROOIRNGP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|