C20H16O9 — CID 163016814
(3'S,6'R,11R,15S,17R)-3',4-dihydroxy-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-17,2'-oxane]-2,4',9,13-tetrone (PubChem CID 163016814) has the molecular formula C20H16O9 and a molecular weight of 400.34 g/mol. Its IUPAC name is (3'S,6'R,11R,15S,17R)-3',4-dihydroxy-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-17,2'-oxane]-2,4',9,13-tetrone.
| Compound Name | (3'S,6'R,11R,15S,17R)-3',4-dihydroxy-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-17,2'-oxane]-2,4',9,13-tetrone |
|---|---|
| PubChem CID | 163016814 |
| Molecular Formula | C20H16O9 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (3'S,6'R,11R,15S,17R)-3',4-dihydroxy-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-17,2'-oxane]-2,4',9,13-tetrone |
| SMILES | C[C@@H]1CC(=O)[C@H](O)[C@]2(O1)O[C@H]1CC(=O)O[C@@H]1C1=C2C(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C20H16O9/c1-7-5-10(22)19(26)20(28-7)15-14(18-11(29-20)6-12(23)27-18)16(24)8-3-2-4-9(21)13(8)17(15)25/h2-4,7,11,18-19,21,26H,5-6H2,1H3/t7-,11+,18+,19+,20-/m1/s1 |
| InChIKey | SKZDTPBXHXHCTG-KXWMXNRYSA-N |
| XLogP | 0.22 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|