C20H18O6 — CID 14588236
(6'S,11S,15S,17R)-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-17,2'-oxane]-2,9,13-trione (PubChem CID 14588236) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (6'S,11S,15S,17R)-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-17,2'-oxane]-2,9,13-trione.
| Compound Name | (6'S,11S,15S,17R)-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-17,2'-oxane]-2,9,13-trione |
|---|---|
| PubChem CID | 14588236 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (6'S,11S,15S,17R)-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-17,2'-oxane]-2,9,13-trione |
| SMILES | C[C@H]1CCC[C@]2(O[C@H]3CC(=O)O[C@H]3C3=C2C(=O)c2ccccc2C3=O)O1 |
| InChI | InChI=1S/C20H18O6/c1-10-5-4-8-20(25-10)16-15(19-13(26-20)9-14(21)24-19)17(22)11-6-2-3-7-12(11)18(16)23/h2-3,6-7,10,13,19H,4-5,8-9H2,1H3/t10-,13-,19+,20+/m0/s1 |
| InChIKey | OEUYGKAVYFGZFF-QAVLDUTCSA-N |
| XLogP | 2.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|