C20H18O8 — CID 162808142
(1R,2'R,10R,11R,15S,17S)-1,10-dihydroxy-2'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-17,6'-2,3-dihydropyran]-2,9,13-trione (PubChem CID 162808142) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is (1R,2'R,10R,11R,15S,17S)-1,10-dihydroxy-2'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-17,6'-2,3-dihydropyran]-2,9,13-trione.
| Compound Name | (1R,2'R,10R,11R,15S,17S)-1,10-dihydroxy-2'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-17,6'-2,3-dihydropyran]-2,9,13-trione |
|---|---|
| PubChem CID | 162808142 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (1R,2'R,10R,11R,15S,17S)-1,10-dihydroxy-2'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-17,6'-2,3-dihydropyran]-2,9,13-trione |
| SMILES | C[C@@H]1CC=C[C@]2(O1)O[C@H]1CC(=O)O[C@H]1[C@]1(O)C(=O)c3ccccc3C(=O)[C@@]21O |
| InChI | InChI=1S/C20H18O8/c1-10-5-4-8-18(27-10)20(25)16(23)12-7-3-2-6-11(12)15(22)19(20,24)17-13(28-18)9-14(21)26-17/h2-4,6-8,10,13,17,24-25H,5,9H2,1H3/t10-,13+,17-,18+,19-,20-/m1/s1 |
| InChIKey | JKAIEKBRNSNOJC-HEYNBSBWSA-N |
| XLogP | 0.30 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|