C12H18O5 — CID 71814622
(1S,3R,7S,8E,11S,12R)-7,11-dihydroxy-3-methyl-4,13-dioxabicyclo[10.1.0]tridec-8-en-5-one (PubChem CID 71814622) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1S,3R,7S,8E,11S,12R)-7,11-dihydroxy-3-methyl-4,13-dioxabicyclo[10.1.0]tridec-8-en-5-one.
| Compound Name | (1S,3R,7S,8E,11S,12R)-7,11-dihydroxy-3-methyl-4,13-dioxabicyclo[10.1.0]tridec-8-en-5-one |
|---|---|
| PubChem CID | 71814622 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1S,3R,7S,8E,11S,12R)-7,11-dihydroxy-3-methyl-4,13-dioxabicyclo[10.1.0]tridec-8-en-5-one |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]2[C@@H](O)C/C=C/[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C12H18O5/c1-7-5-10-12(17-10)9(14)4-2-3-8(13)6-11(15)16-7/h2-3,7-10,12-14H,4-6H2,1H3/b3-2+/t7-,8-,9+,10+,12-/m1/s1 |
| InChIKey | AMANELAQTJACDQ-ZYSZGFIOSA-N |
| XLogP | 0.15 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|