C34H50O8 — CID 146683204
(5E,7E,9E,11E,13E,15E,18S,20S,22S,23E,26S,27E,30S,32S,34S)-18,20,22,26,30,32-hexahydroxy-34-methyl-1-oxacyclotetratriaconta-5,7,9,11,13,15,23,27-octaen-2-one (PubChem CID 146683204) has the molecular formula C34H50O8 and a molecular weight of 586.77 g/mol. Its IUPAC name is (5E,7E,9E,11E,13E,15E,18S,20S,22S,23E,26S,27E,30S,32S,34S)-18,20,22,26,30,32-hexahydroxy-34-methyl-1-oxacyclotetratriaconta-5,7,9,11,13,15,23,27-octaen-2-one.
| Compound Name | (5E,7E,9E,11E,13E,15E,18S,20S,22S,23E,26S,27E,30S,32S,34S)-18,20,22,26,30,32-hexahydroxy-34-methyl-1-oxacyclotetratriaconta-5,7,9,11,13,15,23,27-octaen-2-one |
|---|---|
| PubChem CID | 146683204 |
| Molecular Formula | C34H50O8 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (5E,7E,9E,11E,13E,15E,18S,20S,22S,23E,26S,27E,30S,32S,34S)-18,20,22,26,30,32-hexahydroxy-34-methyl-1-oxacyclotetratriaconta-5,7,9,11,13,15,23,27-octaen-2-one |
| SMILES | C[C@H]1C[C@@H](O)C[C@@H](O)C/C=C/[C@@H](O)C/C=C/[C@@H](O)C[C@@H](O)C[C@@H](O)C/C=C/C=C/C=C/C=C/C=C/C=C/CCC(=O)O1 |
| InChI | InChI=1S/C34H50O8/c1-27-23-32(39)24-30(37)20-15-18-28(35)19-16-21-31(38)26-33(40)25-29(36)17-13-11-9-7-5-3-2-4-6-8-10-12-14-22-34(41)42-27/h2-13,15-16,18,21,27-33,35-40H,14,17,19-20,22-26H2,1H3/b4-2+,5-3+,8-6+,9-7+,12-10+,13-11+,18-15+,21-16+/t27-,28+,29-,30-,31+,32+,33-/m0/s1 |
| InChIKey | YHGHPAXZWKFSBY-UHRIAHHDSA-N |
| XLogP | 4.06 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|