C13H20O5 — CID 162859707
4-hydroxy-10-methoxy-12-methyl-1-oxacyclododec-5-ene-2,8-dione (PubChem CID 162859707) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-hydroxy-10-methoxy-12-methyl-1-oxacyclododec-5-ene-2,8-dione.
| Compound Name | 4-hydroxy-10-methoxy-12-methyl-1-oxacyclododec-5-ene-2,8-dione |
|---|---|
| PubChem CID | 162859707 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-hydroxy-10-methoxy-12-methyl-1-oxacyclododec-5-ene-2,8-dione |
| SMILES | COC1CC(=O)CC=CC(O)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C13H20O5/c1-9-6-12(17-2)7-10(14)4-3-5-11(15)8-13(16)18-9/h3,5,9,11-12,15H,4,6-8H2,1-2H3 |
| InChIKey | FRGUXEKVISRIEL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|