C20H34O6 — CID 163058120
(4S,5R,6R,7S,9R,10S,11E,13E,16R)-7-ethyl-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-1-oxacyclohexadeca-11,13-dien-2-one (PubChem CID 163058120) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (4S,5R,6R,7S,9R,10S,11E,13E,16R)-7-ethyl-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-1-oxacyclohexadeca-11,13-dien-2-one.
| Compound Name | (4S,5R,6R,7S,9R,10S,11E,13E,16R)-7-ethyl-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-1-oxacyclohexadeca-11,13-dien-2-one |
|---|---|
| PubChem CID | 163058120 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (4S,5R,6R,7S,9R,10S,11E,13E,16R)-7-ethyl-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-1-oxacyclohexadeca-11,13-dien-2-one |
| SMILES | CC[C@H]1C[C@@H](C)[C@H](O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H](O)[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C20H34O6/c1-5-15-11-13(2)16(21)10-8-6-7-9-14(3)26-18(23)12-17(22)20(25-4)19(15)24/h6-8,10,13-17,19-22,24H,5,9,11-12H2,1-4H3/b7-6+,10-8+/t13-,14-,15+,16-,17+,19-,20-/m1/s1 |
| InChIKey | XXZCIGRXZDOUGK-AZYSOHNASA-N |
| XLogP | 1.97 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |