C20H32O7 — CID 177449586
2-[(4R,6S,7R,9R,10R,11E,13E,16R)-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (PubChem CID 177449586) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[(4R,6S,7R,9R,10R,11E,13E,16R)-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde.
| Compound Name | 2-[(4R,6S,7R,9R,10R,11E,13E,16R)-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 177449586 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-[(4R,6S,7R,9R,10R,11E,13E,16R)-4,6,10-trihydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
| SMILES | COC1[C@H](O)CC(=O)O[C@H](C)C/C=C/C=C/[C@H](O)[C@H](C)C[C@H](CC=O)[C@@H]1O |
| InChI | InChI=1S/C20H32O7/c1-13-11-15(9-10-21)19(25)20(26-3)17(23)12-18(24)27-14(2)7-5-4-6-8-16(13)22/h4-6,8,10,13-17,19-20,22-23,25H,7,9,11-12H2,1-3H3/b5-4+,8-6+/t13-,14-,15+,16+,17-,19+,20?/m1/s1 |
| InChIKey | BKBWORNUVUBMDZ-LVMJHHNUSA-N |
| XLogP | 1.15 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|