C16H12O6 — CID 102159759
(11S,15S,17S)-6-hydroxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-2,9,13-trione (PubChem CID 102159759) has the molecular formula C16H12O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is (11S,15S,17S)-6-hydroxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-2,9,13-trione.
| Compound Name | (11S,15S,17S)-6-hydroxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-2,9,13-trione |
|---|---|
| PubChem CID | 102159759 |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (11S,15S,17S)-6-hydroxy-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-2,9,13-trione |
| SMILES | C[C@@H]1O[C@H]2CC(=O)O[C@H]2C2=C1C(=O)c1ccc(O)cc1C2=O |
| InChI | InChI=1S/C16H12O6/c1-6-12-13(16-10(21-6)5-11(18)22-16)15(20)9-4-7(17)2-3-8(9)14(12)19/h2-4,6,10,16-17H,5H2,1H3/t6-,10-,16+/m0/s1 |
| InChIKey | CWZBRZLHONHNHZ-LLTVHCASSA-N |
| XLogP | 1.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|