C22H18O8 — CID 101285694
(4S,8S,10S)-2,12-dihydroxy-16-(1-hydroxyethyl)-10-methyl-5,9-dioxapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3(11),12,15(20),16,18-hexaene-6,14,21-trione (PubChem CID 101285694) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is (4S,8S,10S)-2,12-dihydroxy-16-(1-hydroxyethyl)-10-methyl-5,9-dioxapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3(11),12,15(20),16,18-hexaene-6,14,21-trione.
| Compound Name | (4S,8S,10S)-2,12-dihydroxy-16-(1-hydroxyethyl)-10-methyl-5,9-dioxapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3(11),12,15(20),16,18-hexaene-6,14,21-trione |
|---|---|
| PubChem CID | 101285694 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (4S,8S,10S)-2,12-dihydroxy-16-(1-hydroxyethyl)-10-methyl-5,9-dioxapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3(11),12,15(20),16,18-hexaene-6,14,21-trione |
| SMILES | CC(O)c1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)[C@@H]1OC(=O)C[C@@H]1O[C@H]3C |
| InChI | InChI=1S/C22H18O8/c1-7(23)9-4-3-5-10-14(9)20(27)16-15(18(10)25)21(28)17-13(19(16)26)8(2)29-11-6-12(24)30-22(11)17/h3-5,7-8,11,22-23,26,28H,6H2,1-2H3/t7?,8-,11-,22+/m0/s1 |
| InChIKey | CIVDMICROXQXLC-KHTJLTNQSA-N |
| XLogP | 2.37 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|