C28H30O13 — CID 154804757
(13S)-23-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-5,15,19-trihydroxy-13,20-dimethyl-8,12,21-trioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione (PubChem CID 154804757) has the molecular formula C28H30O13 and a molecular weight of 574.54 g/mol. Its IUPAC name is (13S)-23-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-5,15,19-trihydroxy-13,20-dimethyl-8,12,21-trioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione.
| Compound Name | (13S)-23-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-5,15,19-trihydroxy-13,20-dimethyl-8,12,21-trioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione |
|---|---|
| PubChem CID | 154804757 |
| Molecular Formula | C28H30O13 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (13S)-23-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-5,15,19-trihydroxy-13,20-dimethyl-8,12,21-trioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione |
| SMILES | CC1OC(OC2CC3OC(C)C2(O)C2=C3C(=O)c3c(O)c4c(c(O)c3C2=O)[C@H](C)OC2CC(=O)OC42)CC(O)C1O |
| InChI | InChI=1S/C28H30O13/c1-7-16-20(27-12(37-7)6-14(30)41-27)25(34)18-19(23(16)32)26(35)21-17(24(18)33)11-5-13(28(21,36)9(3)39-11)40-15-4-10(29)22(31)8(2)38-15/h7-13,15,22,27,29,31-32,34,36H,4-6H2,1-3H3/t7-,8?,9?,10?,11?,12?,13?,15?,22?,27?,28?/m0/s1 |
| InChIKey | GMMDPKJIGLVUCK-GCRQQLTLSA-N |
| XLogP | 0.39 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|