C29H34O13 — CID 137256752
methyl 2-[(7S,9S,10S)-1,3,10,14-tetrahydroxy-19-(5-hydroxy-6-methyloxan-2-yl)oxy-7,18-dimethyl-5,12-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),3,6(11),13-tetraen-9-yl]acetate (PubChem CID 137256752) has the molecular formula C29H34O13 and a molecular weight of 590.58 g/mol. Its IUPAC name is methyl 2-[(7S,9S,10S)-1,3,10,14-tetrahydroxy-19-(5-hydroxy-6-methyloxan-2-yl)oxy-7,18-dimethyl-5,12-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),3,6(11),13-tetraen-9-yl]acetate.
| Compound Name | methyl 2-[(7S,9S,10S)-1,3,10,14-tetrahydroxy-19-(5-hydroxy-6-methyloxan-2-yl)oxy-7,18-dimethyl-5,12-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),3,6(11),13-tetraen-9-yl]acetate |
|---|---|
| PubChem CID | 137256752 |
| Molecular Formula | C29H34O13 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | methyl 2-[(7S,9S,10S)-1,3,10,14-tetrahydroxy-19-(5-hydroxy-6-methyloxan-2-yl)oxy-7,18-dimethyl-5,12-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),3,6(11),13-tetraen-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H](C)C2=C(C(=O)c3c(O)c4c(c(O)c3C2=O)C2(O)C(C)OC4CC2OC2CCC(O)C(C)O2)[C@@H]1O |
| InChI | InChI=1S/C29H34O13/c1-9-12(30)5-6-17(40-9)42-15-7-13-19-23(29(15,37)11(3)41-13)28(36)22-21(26(19)34)27(35)20-18(25(22)33)10(2)39-14(24(20)32)8-16(31)38-4/h9-15,17,24,30,32,34,36-37H,5-8H2,1-4H3/t9?,10-,11?,12?,13?,14-,15?,17?,24+,29?/m0/s1 |
| InChIKey | HOVGTAOFFSSHJW-QWUAGISRSA-N |
| XLogP | 0.81 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|