C17H16O7 — CID 10936479
methyl 2-[(1R,3S)-5,10-dihydroxy-1-methyl-6,9-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate (PubChem CID 10936479) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is methyl 2-[(1R,3S)-5,10-dihydroxy-1-methyl-6,9-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate.
| Compound Name | methyl 2-[(1R,3S)-5,10-dihydroxy-1-methyl-6,9-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
|---|---|
| PubChem CID | 10936479 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 2-[(1R,3S)-5,10-dihydroxy-1-methyl-6,9-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1Cc2c(O)c3c(c(O)c2[C@@H](C)O1)C(=O)C=CC3=O |
| InChI | InChI=1S/C17H16O7/c1-7-13-9(5-8(24-7)6-12(20)23-2)16(21)14-10(18)3-4-11(19)15(14)17(13)22/h3-4,7-8,21-22H,5-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | YYOZXILWZQXDEB-SFYZADRCSA-N |
| XLogP | 1.60 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|