C19H18N2O7 — CID 135750130
methyl 2-(5,10-dihydroxy-1,9-dimethyl-4,11-dioxo-7,9-dihydro-6H-isochromeno[6,7-f]indazol-7-yl)acetate (PubChem CID 135750130) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is methyl 2-(5,10-dihydroxy-1,9-dimethyl-4,11-dioxo-7,9-dihydro-6H-isochromeno[6,7-f]indazol-7-yl)acetate.
| Compound Name | methyl 2-(5,10-dihydroxy-1,9-dimethyl-4,11-dioxo-7,9-dihydro-6H-isochromeno[6,7-f]indazol-7-yl)acetate |
|---|---|
| PubChem CID | 135750130 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl 2-(5,10-dihydroxy-1,9-dimethyl-4,11-dioxo-7,9-dihydro-6H-isochromeno[6,7-f]indazol-7-yl)acetate |
| SMILES | COC(=O)CC1Cc2c(O)c3c(c(O)c2C(C)O1)C(=O)c1c(cnn1C)C3=O |
| InChI | InChI=1S/C19H18N2O7/c1-7-12-9(4-8(28-7)5-11(22)27-3)16(23)13-14(18(12)25)19(26)15-10(17(13)24)6-20-21(15)2/h6-8,23,25H,4-5H2,1-3H3 |
| InChIKey | DNOYWLMEOALLLZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|