C16H16O7 — CID 162924594
(1R,3S)-5,6,10-trihydroxy-7-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-8,9-dione (PubChem CID 162924594) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is (1R,3S)-5,6,10-trihydroxy-7-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-8,9-dione.
| Compound Name | (1R,3S)-5,6,10-trihydroxy-7-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-8,9-dione |
|---|---|
| PubChem CID | 162924594 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (1R,3S)-5,6,10-trihydroxy-7-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-8,9-dione |
| SMILES | COC1=C(O)c2c(O)c3c(c(O)c2C(=O)C1=O)[C@@H](C)O[C@@H](C)C3 |
| InChI | InChI=1S/C16H16O7/c1-5-4-7-8(6(2)23-5)12(18)10-9(11(7)17)14(20)16(22-3)15(21)13(10)19/h5-6,17-18,20H,4H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | XUALFHRTZHBZFR-NTSWFWBYSA-N |
| XLogP | 1.76 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|