C15H12O7 — CID 71436981
methyl 4,9-dihydroxy-2-methyl-5,8-dioxo-2,3-dihydrobenzo[f][1]benzofuran-7-carboxylate (PubChem CID 71436981) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is methyl 4,9-dihydroxy-2-methyl-5,8-dioxo-2,3-dihydrobenzo[f][1]benzofuran-7-carboxylate.
| Compound Name | methyl 4,9-dihydroxy-2-methyl-5,8-dioxo-2,3-dihydrobenzo[f][1]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 71436981 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 4,9-dihydroxy-2-methyl-5,8-dioxo-2,3-dihydrobenzo[f][1]benzofuran-7-carboxylate |
| SMILES | COC(=O)C1=CC(=O)c2c(O)c3c(c(O)c2C1=O)OC(C)C3 |
| InChI | InChI=1S/C15H12O7/c1-5-3-6-11(17)9-8(16)4-7(15(20)21-2)12(18)10(9)13(19)14(6)22-5/h4-5,17,19H,3H2,1-2H3 |
| InChIKey | ZSCYHGRTPAVNSQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|