C17H14O8 — CID 139589590
(11S,13S,15S)-2,9-dihydroxy-6-methoxy-13-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-4,7,17-trione (PubChem CID 139589590) has the molecular formula C17H14O8 and a molecular weight of 346.29 g/mol. Its IUPAC name is (11S,13S,15S)-2,9-dihydroxy-6-methoxy-13-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-4,7,17-trione.
| Compound Name | (11S,13S,15S)-2,9-dihydroxy-6-methoxy-13-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-4,7,17-trione |
|---|---|
| PubChem CID | 139589590 |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (11S,13S,15S)-2,9-dihydroxy-6-methoxy-13-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-4,7,17-trione |
| SMILES | COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)[C@@H]1O[C@@H](C)C[C@@H]1OC3=O |
| InChI | InChI=1S/C17H14O8/c1-5-3-8-16(24-5)11-12(17(22)25-8)14(20)9-6(18)4-7(23-2)13(19)10(9)15(11)21/h4-5,8,16,20-21H,3H2,1-2H3/t5-,8-,16+/m0/s1 |
| InChIKey | ODLITKBPRSEDKS-XPVFSCPNSA-N |
| XLogP | 1.40 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|