C17H18O8 — CID 162845562
4,5,10-trihydroxy-2-(2-hydroxypropyl)-8-methoxy-3,4-dihydro-2H-benzo[g]chromene-6,9-dione (PubChem CID 162845562) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 4,5,10-trihydroxy-2-(2-hydroxypropyl)-8-methoxy-3,4-dihydro-2H-benzo[g]chromene-6,9-dione.
| Compound Name | 4,5,10-trihydroxy-2-(2-hydroxypropyl)-8-methoxy-3,4-dihydro-2H-benzo[g]chromene-6,9-dione |
|---|---|
| PubChem CID | 162845562 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4,5,10-trihydroxy-2-(2-hydroxypropyl)-8-methoxy-3,4-dihydro-2H-benzo[g]chromene-6,9-dione |
| SMILES | COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)OC(CC(C)O)CC3O |
| InChI | InChI=1S/C17H18O8/c1-6(18)3-7-4-8(19)12-15(22)11-9(20)5-10(24-2)14(21)13(11)16(23)17(12)25-7/h5-8,18-19,22-23H,3-4H2,1-2H3 |
| InChIKey | ZCGCJXOIYGMTSC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|