C19H18O9 — CID 162964157
methyl 3,10-dihydroxy-7-methoxy-13-methyl-5,8-dioxo-14,17-dioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,6,9-tetraene-15-carboxylate (PubChem CID 162964157) has the molecular formula C19H18O9 and a molecular weight of 390.34 g/mol. Its IUPAC name is methyl 3,10-dihydroxy-7-methoxy-13-methyl-5,8-dioxo-14,17-dioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,6,9-tetraene-15-carboxylate.
| Compound Name | methyl 3,10-dihydroxy-7-methoxy-13-methyl-5,8-dioxo-14,17-dioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,6,9-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 162964157 |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 3,10-dihydroxy-7-methoxy-13-methyl-5,8-dioxo-14,17-dioxatetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,6,9-tetraene-15-carboxylate |
| SMILES | COC(=O)C1CC2OC(C)(Cc3c(O)c4c(c(O)c32)C(=O)C=C(OC)C4=O)O1 |
| InChI | InChI=1S/C19H18O9/c1-19-6-7-12(9(27-19)5-11(28-19)18(24)26-3)17(23)13-8(20)4-10(25-2)16(22)14(13)15(7)21/h4,9,11,21,23H,5-6H2,1-3H3 |
| InChIKey | HDGQCYJXSNCTQM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|