C18H21NO7 — CID 71456049
(5S,7S)-5,7,9,10-tetrahydroxy-2-(2-methoxyethylamino)-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione (PubChem CID 71456049) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is (5S,7S)-5,7,9,10-tetrahydroxy-2-(2-methoxyethylamino)-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione.
| Compound Name | (5S,7S)-5,7,9,10-tetrahydroxy-2-(2-methoxyethylamino)-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione |
|---|---|
| PubChem CID | 71456049 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (5S,7S)-5,7,9,10-tetrahydroxy-2-(2-methoxyethylamino)-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione |
| SMILES | COCCNC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)C[C@](C)(O)C[C@@H]3O |
| InChI | InChI=1S/C18H21NO7/c1-18(25)6-8-12(11(21)7-18)17(24)13-10(20)5-9(19-3-4-26-2)16(23)14(13)15(8)22/h5,11,19,21-22,24-25H,3-4,6-7H2,1-2H3/t11-,18-/m0/s1 |
| InChIKey | JKDMCGBFZGHGIL-VOJFVSQTSA-N |
| XLogP | 0.33 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|