C31H37NO9 — CID 70521263
[1-oxo-1-(propylamino)octan-4-yl] 2-[(2R,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]acetate (PubChem CID 70521263) has the molecular formula C31H37NO9 and a molecular weight of 567.64 g/mol. Its IUPAC name is [1-oxo-1-(propylamino)octan-4-yl] 2-[(2R,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]acetate.
| Compound Name | [1-oxo-1-(propylamino)octan-4-yl] 2-[(2R,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]acetate |
|---|---|
| PubChem CID | 70521263 |
| Molecular Formula | C31H37NO9 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | [1-oxo-1-(propylamino)octan-4-yl] 2-[(2R,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]acetate |
| SMILES | CCCCC(CCC(=O)NCCC)OC(=O)C[C@@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C31H37NO9/c1-3-5-8-17(11-12-22(34)32-13-4-2)41-23(35)16-31(40)14-20-24(21(33)15-31)30(39)26-25(29(20)38)27(36)18-9-6-7-10-19(18)28(26)37/h6-7,9-10,17,21,33,38-40H,3-5,8,11-16H2,1-2H3,(H,32,34)/t17?,21-,31+/m0/s1 |
| InChIKey | QITKWIHWSRTLSE-AUAXPYSLSA-N |
| XLogP | 3.38 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|