C21H18O8 — CID 14760066
[(2S,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl acetate (PubChem CID 14760066) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is [(2S,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl acetate.
| Compound Name | [(2S,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14760066 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(2S,4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C21H18O8/c1-9(22)29-8-21(28)6-12-14(13(23)7-21)20(27)16-15(19(12)26)17(24)10-4-2-3-5-11(10)18(16)25/h2-5,13,23,26-28H,6-8H2,1H3/t13-,21-/m0/s1 |
| InChIKey | RSTAEYYSTDRHSR-ZSEKCTLFSA-N |
| XLogP | 1.15 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|