C26H20N2O10 — CID 57020744
[(4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate (PubChem CID 57020744) has the molecular formula C26H20N2O10 and a molecular weight of 520.45 g/mol. Its IUPAC name is [(4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate.
| Compound Name | [(4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 57020744 |
| Molecular Formula | C26H20N2O10 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | [(4S)-2,4,5,12-tetrahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)OCC1(O)Cc2c(O)c3c(c(O)c2[C@@H](O)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C26H20N2O10/c29-17-10-26(35,11-38-25(34)27-12-5-7-13(8-6-12)28(36)37)9-16-18(17)24(33)20-19(23(16)32)21(30)14-3-1-2-4-15(14)22(20)31/h1-8,17,29,32-33,35H,9-11H2,(H,27,34)/t17-,26?/m0/s1 |
| InChIKey | XJMOCTAMVXQONP-WFFHQLTOSA-N |
| XLogP | 2.74 |
| TPSA | 196.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|