C21H18O6 — CID 70886719
(7S,9R)-9-acetyl-6,9,11-trihydroxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70886719) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is (7S,9R)-9-acetyl-6,9,11-trihydroxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9R)-9-acetyl-6,9,11-trihydroxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70886719 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (7S,9R)-9-acetyl-6,9,11-trihydroxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](C)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C21H18O6/c1-9-7-21(27,10(2)22)8-13-14(9)20(26)16-15(19(13)25)17(23)11-5-3-4-6-12(11)18(16)24/h3-6,9,25-27H,7-8H2,1-2H3/t9-,21+/m0/s1 |
| InChIKey | MNHFASOBAYKVJC-JLTPVHFHSA-N |
| XLogP | 2.24 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|