C18H14O7S — CID 23260017
(6R,8R)-8-acetyl-5,6,8,10-tetrahydroxy-7,9-dihydro-6H-naphtho[2,3-f][1]benzothiole-4,11-dione (PubChem CID 23260017) has the molecular formula C18H14O7S and a molecular weight of 374.37 g/mol. Its IUPAC name is (6R,8R)-8-acetyl-5,6,8,10-tetrahydroxy-7,9-dihydro-6H-naphtho[2,3-f][1]benzothiole-4,11-dione.
| Compound Name | (6R,8R)-8-acetyl-5,6,8,10-tetrahydroxy-7,9-dihydro-6H-naphtho[2,3-f][1]benzothiole-4,11-dione |
|---|---|
| PubChem CID | 23260017 |
| Molecular Formula | C18H14O7S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (6R,8R)-8-acetyl-5,6,8,10-tetrahydroxy-7,9-dihydro-6H-naphtho[2,3-f][1]benzothiole-4,11-dione |
| SMILES | CC(=O)[C@@]1(O)Cc2c(O)c3c(c(O)c2[C@H](O)C1)C(=O)c1ccsc1C3=O |
| InChI | InChI=1S/C18H14O7S/c1-6(19)18(25)4-8-10(9(20)5-18)15(23)11-12(14(8)22)16(24)17-7(13(11)21)2-3-26-17/h2-3,9,20,22-23,25H,4-5H2,1H3/t9-,18-/m1/s1 |
| InChIKey | JNNUIBURIGADJX-DYBLOJMWSA-N |
| XLogP | 1.23 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|