C20H16O7 — CID 13453494
9-acetyl-4,7,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 13453494) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is 9-acetyl-4,7,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-acetyl-4,7,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 13453494 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 9-acetyl-4,7,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)C1(O)Cc2c(cc3c(c2O)C(=O)c2cccc(O)c2C3=O)C(O)C1 |
| InChI | InChI=1S/C20H16O7/c1-8(21)20(27)6-12-10(14(23)7-20)5-11-16(19(12)26)17(24)9-3-2-4-13(22)15(9)18(11)25/h2-5,14,22-23,26-27H,6-7H2,1H3 |
| InChIKey | LNEBYJZWOYTDFZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|