C34H32O15 — CID 23260644
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,3S)-3-ethynyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 23260644) has the molecular formula C34H32O15 and a molecular weight of 680.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,3S)-3-ethynyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,3S)-3-ethynyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23260644 |
| Molecular Formula | C34H32O15 |
| Molecular Weight | 680.62 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,3S)-3-ethynyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | C#C[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C34H32O15/c1-6-34(43)11-20-23(29(42)25-24(28(20)41)26(39)18-9-7-8-10-19(18)27(25)40)21(12-34)48-33-32(47-17(5)38)31(46-16(4)37)30(45-15(3)36)22(49-33)13-44-14(2)35/h1,7-10,21-22,30-33,41-43H,11-13H2,2-5H3/t21-,22+,30+,31-,32+,33+,34-/m0/s1 |
| InChIKey | PFKRFONYRAJKLH-MIHKXDMQSA-N |
| XLogP | 1.32 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|