C25H26O14 — CID 162998731
[3,4,5-triacetyloxy-6-(5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 162998731) has the molecular formula C25H26O14 and a molecular weight of 550.47 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162998731 |
| Molecular Formula | C25H26O14 |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC2=C(C)C(=O)c3c(O)ccc(O)c3C2=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H26O14/c1-9-19(32)17-14(30)6-7-15(31)18(17)20(33)21(9)39-25-24(37-13(5)29)23(36-12(4)28)22(35-11(3)27)16(38-25)8-34-10(2)26/h6-7,16,22-25,30-31H,8H2,1-5H3 |
| InChIKey | MCRNXFBUNYEMLM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|