C26H26Cl2O14 — CID 3821263
[3,4,5-triacetyloxy-6-(6,7-dichloro-3-ethyl-5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 3821263) has the molecular formula C26H26Cl2O14 and a molecular weight of 633.39 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(6,7-dichloro-3-ethyl-5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(6,7-dichloro-3-ethyl-5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3821263 |
| Molecular Formula | C26H26Cl2O14 |
| Molecular Weight | 633.39 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(6,7-dichloro-3-ethyl-5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CCC1=C(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(=O)c2c(O)c(Cl)c(Cl)c(O)c2C1=O |
| InChI | InChI=1S/C26H26Cl2O14/c1-6-12-18(33)14-15(20(35)17(28)16(27)19(14)34)21(36)22(12)42-26-25(40-11(5)32)24(39-10(4)31)23(38-9(3)30)13(41-26)7-37-8(2)29/h13,23-26,34-35H,6-7H2,1-5H3 |
| InChIKey | CZUNPHDKOQTAAB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|