C25H24Cl2O14 — CID 163069182
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(6,7-dichloro-5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 163069182) has the molecular formula C25H24Cl2O14 and a molecular weight of 619.36 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(6,7-dichloro-5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(6,7-dichloro-5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163069182 |
| Molecular Formula | C25H24Cl2O14 |
| Molecular Weight | 619.36 g/mol |
| Exact Mass | 618.05 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(6,7-dichloro-5,8-dihydroxy-3-methyl-1,4-dioxonaphthalen-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC2=C(C)C(=O)c3c(O)c(Cl)c(Cl)c(O)c3C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H24Cl2O14/c1-7-17(32)13-14(19(34)16(27)15(26)18(13)33)20(35)21(7)41-25-24(39-11(5)31)23(38-10(4)30)22(37-9(3)29)12(40-25)6-36-8(2)28/h12,22-25,33-34H,6H2,1-5H3/t12-,22-,23+,24-,25-/m1/s1 |
| InChIKey | KDAKZYMFENBLJN-PTOABSMPSA-N |
| XLogP | 2.16 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|