C24H18O6 — CID 122385835
3,4,11-trihydroxy-1-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b]anthracene-5,10-dione (PubChem CID 122385835) has the molecular formula C24H18O6 and a molecular weight of 402.40 g/mol. Its IUPAC name is 3,4,11-trihydroxy-1-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b]anthracene-5,10-dione.
| Compound Name | 3,4,11-trihydroxy-1-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b]anthracene-5,10-dione |
|---|---|
| PubChem CID | 122385835 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3,4,11-trihydroxy-1-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b]anthracene-5,10-dione |
| SMILES | COc1ccc(C2CC(O)c3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)cc1 |
| InChI | InChI=1S/C24H18O6/c1-30-12-8-6-11(7-9-12)15-10-16(25)18-17(15)23(28)19-20(24(18)29)22(27)14-5-3-2-4-13(14)21(19)26/h2-9,15-16,25,28-29H,10H2,1H3 |
| InChIKey | GNKMIZVWBWCHSJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|