C17H18O6 — CID 162931023
(1R,3R)-6-hydroxy-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 162931023) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (1R,3R)-6-hydroxy-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (1R,3R)-6-hydroxy-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 162931023 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (1R,3R)-6-hydroxy-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC)c2c(c1O)C(=O)C1=C(C2=O)[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C17H18O6/c1-7-5-9-12(8(2)23-7)17(20)13-10(21-3)6-11(22-4)16(19)14(13)15(9)18/h6-8,19H,5H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | WHBCVTVKNXFICH-HTQZYQBOSA-N |
| XLogP | 2.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|