C19H22O6 — CID 154709448
(1R,3S)-1,9-dimethoxy-3-methyl-7-propan-2-yloxy-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 154709448) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1R,3S)-1,9-dimethoxy-3-methyl-7-propan-2-yloxy-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (1R,3S)-1,9-dimethoxy-3-methyl-7-propan-2-yloxy-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 154709448 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (1R,3S)-1,9-dimethoxy-3-methyl-7-propan-2-yloxy-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC(C)C)cc2c1C(=O)C1=C(C[C@H](C)O[C@H]1OC)C2=O |
| InChI | InChI=1S/C19H22O6/c1-9(2)24-11-7-13-15(14(8-11)22-4)18(21)16-12(17(13)20)6-10(3)25-19(16)23-5/h7-10,19H,6H2,1-5H3/t10-,19+/m0/s1 |
| InChIKey | WGQVOAZBMWZALS-APBUJDDRSA-N |
| XLogP | 2.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|