C21H26O5 — CID 46228311
(1R,3S)-6-tert-butyl-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 46228311) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1R,3S)-6-tert-butyl-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (1R,3S)-6-tert-butyl-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 46228311 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1R,3S)-6-tert-butyl-7,9-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC)c(C(C)(C)C)c2c1C(=O)C1=C(C[C@H](C)O[C@@H]1C)C2=O |
| InChI | InChI=1S/C21H26O5/c1-10-8-12-15(11(2)26-10)20(23)16-13(24-6)9-14(25-7)18(21(3,4)5)17(16)19(12)22/h9-11H,8H2,1-7H3/t10-,11+/m0/s1 |
| InChIKey | HUKQPYRBQFPSPL-WDEREUQCSA-N |
| XLogP | 3.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|