C22H22O11 — CID 627112
(2,8-diacetyloxy-3,5-dihydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate (PubChem CID 627112) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is (2,8-diacetyloxy-3,5-dihydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate.
| Compound Name | (2,8-diacetyloxy-3,5-dihydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate |
|---|---|
| PubChem CID | 627112 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (2,8-diacetyloxy-3,5-dihydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate |
| SMILES | COc1cc(OC(C)=O)c2c(c1O)C(=O)C1=C(C2=O)C(OC(C)=O)C(OC(C)=O)C(C)(O)C1 |
| InChI | InChI=1S/C22H22O11/c1-8(23)31-12-6-13(30-5)18(27)16-15(12)19(28)14-11(17(16)26)7-22(4,29)21(33-10(3)25)20(14)32-9(2)24/h6,20-21,27,29H,7H2,1-5H3 |
| InChIKey | SGWBYQZIDOWEPV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|