C24H24O12 — CID 163053408
(2,4,8-triacetyloxy-3-hydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate (PubChem CID 163053408) has the molecular formula C24H24O12 and a molecular weight of 504.44 g/mol. Its IUPAC name is (2,4,8-triacetyloxy-3-hydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate.
| Compound Name | (2,4,8-triacetyloxy-3-hydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate |
|---|---|
| PubChem CID | 163053408 |
| Molecular Formula | C24H24O12 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | (2,4,8-triacetyloxy-3-hydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl) acetate |
| SMILES | COc1cc(OC(C)=O)c2c(c1)C(=O)C1=C(C2=O)C(OC(C)=O)C(OC(C)=O)C(C)(O)C1OC(C)=O |
| InChI | InChI=1S/C24H24O12/c1-9(25)33-15-8-13(32-6)7-14-16(15)20(30)17-18(19(14)29)22(35-11(3)27)24(5,31)23(36-12(4)28)21(17)34-10(2)26/h7-8,21-23,31H,1-6H3 |
| InChIKey | BBNIRZPZESGMEK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|