C16H15NO9 — CID 139191021
[(3S,4S)-3-hydroxy-7,9-dimethoxy-3-methyl-5,10-dioxo-1,4-dihydrobenzo[g]isochromen-4-yl] nitrate (PubChem CID 139191021) has the molecular formula C16H15NO9 and a molecular weight of 365.29 g/mol. Its IUPAC name is [(3S,4S)-3-hydroxy-7,9-dimethoxy-3-methyl-5,10-dioxo-1,4-dihydrobenzo[g]isochromen-4-yl] nitrate.
| Compound Name | [(3S,4S)-3-hydroxy-7,9-dimethoxy-3-methyl-5,10-dioxo-1,4-dihydrobenzo[g]isochromen-4-yl] nitrate |
|---|---|
| PubChem CID | 139191021 |
| Molecular Formula | C16H15NO9 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [(3S,4S)-3-hydroxy-7,9-dimethoxy-3-methyl-5,10-dioxo-1,4-dihydrobenzo[g]isochromen-4-yl] nitrate |
| SMILES | COc1cc(OC)c2c(c1)C(=O)C1=C(CO[C@](C)(O)[C@H]1O[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C16H15NO9/c1-16(20)15(26-17(21)22)12-9(6-25-16)14(19)11-8(13(12)18)4-7(23-2)5-10(11)24-3/h4-5,15,20H,6H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | MHWOQBMIFQZJHK-HOTGVXAUSA-N |
| XLogP | 0.69 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|