C18H17ClO4 — CID 68612439
[2-chloro-4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] acetate (PubChem CID 68612439) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is [2-chloro-4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] acetate.
| Compound Name | [2-chloro-4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 68612439 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [2-chloro-4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] acetate |
| SMILES | COc1cc(C=Cc2ccc(OC(C)=O)c(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H17ClO4/c1-12(20)23-18-7-6-13(10-17(18)19)4-5-14-8-15(21-2)11-16(9-14)22-3/h4-11H,1-3H3 |
| InChIKey | VDIKDQFVGLYTOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|